C20H21NO4 — CID 57341433
2-prop-2-enyl-3-(2,4,6-trimethoxyphenyl)-3H-isoindol-1-one (PubChem CID 57341433) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-prop-2-enyl-3-(2,4,6-trimethoxyphenyl)-3H-isoindol-1-one.
| Compound Name | 2-prop-2-enyl-3-(2,4,6-trimethoxyphenyl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 57341433 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-prop-2-enyl-3-(2,4,6-trimethoxyphenyl)-3H-isoindol-1-one |
| SMILES | C=CCN1C(=O)c2ccccc2C1c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C20H21NO4/c1-5-10-21-19(14-8-6-7-9-15(14)20(21)22)18-16(24-3)11-13(23-2)12-17(18)25-4/h5-9,11-12,19H,1,10H2,2-4H3 |
| InChIKey | TXCCDXUJYDPCKS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|