C14H16O4 — CID 57341713
(1S,3R,7R,12S)-3-methoxy-4,9-dioxatetracyclo[9.3.1.03,12.07,12]pentadeca-11(15),13-dien-2-one (PubChem CID 57341713) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (1S,3R,7R,12S)-3-methoxy-4,9-dioxatetracyclo[9.3.1.03,12.07,12]pentadeca-11(15),13-dien-2-one.
| Compound Name | (1S,3R,7R,12S)-3-methoxy-4,9-dioxatetracyclo[9.3.1.03,12.07,12]pentadeca-11(15),13-dien-2-one |
|---|---|
| PubChem CID | 57341713 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (1S,3R,7R,12S)-3-methoxy-4,9-dioxatetracyclo[9.3.1.03,12.07,12]pentadeca-11(15),13-dien-2-one |
| SMILES | CO[C@@]12OCC[C@H]3COCC4=C[C@H](C=C[C@@]431)C2=O |
| InChI | InChI=1S/C14H16O4/c1-16-14-12(15)9-2-4-13(14)10(3-5-18-14)7-17-8-11(13)6-9/h2,4,6,9-10H,3,5,7-8H2,1H3/t9-,10-,13-,14-/m0/s1 |
| InChIKey | YOUXHOWRLPOPLD-NUZBWSBOSA-N |
| XLogP | 1.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|