About 2-propylpentyl N-methylcarbamate
2-propylpentyl N-methylcarbamate (PubChem CID 57342030) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is 2-propylpentyl N-methylcarbamate.
Molecular Properties
| Compound Name | 2-propylpentyl N-methylcarbamate |
| PubChem CID | 57342030 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 2-propylpentyl N-methylcarbamate |
| SMILES | CCCC(CCC)COC(=O)NC |
| InChI | InChI=1S/C10H21NO2/c1-4-6-9(7-5-2)8-13-10(12)11-3/h9H,4-8H2,1-3H3,(H,11,12) |
| InChIKey | HPQSSMIWHZDDLU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propylpentyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylpentyl N-methylcarbamate?
The IUPAC name of 2-propylpentyl N-methylcarbamate (CID 57342030) is 2-propylpentyl N-methylcarbamate.
What is the SMILES notation for 2-propylpentyl N-methylcarbamate?
The canonical SMILES for 2-propylpentyl N-methylcarbamate is CCCC(CCC)COC(=O)NC.
What is the InChIKey of 2-propylpentyl N-methylcarbamate?
The InChIKey is HPQSSMIWHZDDLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-4-6-9(7-5-2)8-13-10(12)11-3/h9H,4-8H2,1-3H3,(H,11,12).
What are the key properties of 2-propylpentyl N-methylcarbamate?
2-propylpentyl N-methylcarbamate has a molecular weight of 187.28 g/mol, XLogP of 2.56, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylpentyl N-methylcarbamate is sourced from PubChem (CID 57342030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).