C25H20ClN5O2 — CID 57342207
N-[3-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrimidin-5-yl]phenyl]prop-2-enamide (PubChem CID 57342207) has the molecular formula C25H20ClN5O2 and a molecular weight of 457.92 g/mol. Its IUPAC name is N-[3-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrimidin-5-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrimidin-5-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 57342207 |
| Molecular Formula | C25H20ClN5O2 |
| Molecular Weight | 457.92 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | N-[3-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrimidin-5-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2cncnc2Nc2ccc(OCc3ccccn3)c(Cl)c2)c1 |
| InChI | InChI=1S/C25H20ClN5O2/c1-2-24(32)30-18-8-5-6-17(12-18)21-14-27-16-29-25(21)31-19-9-10-23(22(26)13-19)33-15-20-7-3-4-11-28-20/h2-14,16H,1,15H2,(H,30,32)(H,27,29,31) |
| InChIKey | YTDGAUZFNHXIMR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.92 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|