C38H78O6Si3 — CID 57342227
tert-butyl (E,3R,5S,6R,7R,10R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,10-pentamethyl-11-oxo-5-triethylsilyloxyundec-8-enoate (PubChem CID 57342227) has the molecular formula C38H78O6Si3 and a molecular weight of 715.29 g/mol. Its IUPAC name is tert-butyl (E,3R,5S,6R,7R,10R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,10-pentamethyl-11-oxo-5-triethylsilyloxyundec-8-enoate.
| Compound Name | tert-butyl (E,3R,5S,6R,7R,10R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,10-pentamethyl-11-oxo-5-triethylsilyloxyundec-8-enoate |
|---|---|
| PubChem CID | 57342227 |
| Molecular Formula | C38H78O6Si3 |
| Molecular Weight | 715.29 g/mol |
| Exact Mass | 714.51 |
| IUPAC Name | tert-butyl (E,3R,5S,6R,7R,10R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,10-pentamethyl-11-oxo-5-triethylsilyloxyundec-8-enoate |
| SMILES | CC[Si](CC)(CC)O[C@@H]([C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@@H](C)C=O)C(C)(C)[C@@H](CC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H78O6Si3/c1-22-47(23-2,24-3)44-34(30(6)33(29(5)25-28(4)27-39)43-46(20,21)37(13,14)15)38(16,17)31(26-32(40)41-35(7,8)9)42-45(18,19)36(10,11)12/h25,27-28,30-31,33-34H,22-24,26H2,1-21H3/b29-25+/t28-,30-,31-,33+,34+/m1/s1 |
| InChIKey | LYNVEJPQJJXHDO-PMZYZWIZSA-N |
| XLogP | 11.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.29 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|