C22H14Br2N2 — CID 57342616
3,5-dibromo-4-(3,5-diphenyl-4-pyridinyl)pyridine (PubChem CID 57342616) has the molecular formula C22H14Br2N2 and a molecular weight of 466.18 g/mol. Its IUPAC name is 3,5-dibromo-4-(3,5-diphenyl-4-pyridinyl)pyridine.
| Compound Name | 3,5-dibromo-4-(3,5-diphenyl-4-pyridinyl)pyridine |
|---|---|
| PubChem CID | 57342616 |
| Molecular Formula | C22H14Br2N2 |
| Molecular Weight | 466.18 g/mol |
| Exact Mass | 463.95 |
| IUPAC Name | 3,5-dibromo-4-(3,5-diphenyl-4-pyridinyl)pyridine |
| SMILES | Brc1cncc(Br)c1-c1c(-c2ccccc2)cncc1-c1ccccc1 |
| InChI | InChI=1S/C22H14Br2N2/c23-19-13-26-14-20(24)22(19)21-17(15-7-3-1-4-8-15)11-25-12-18(21)16-9-5-2-6-10-16/h1-14H |
| InChIKey | PCJUSQMLXXOZKF-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.18 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |