C24H31FIN2O8P — CID 57342686
1-[(2R,4S,5R)-4-[(6,8-ditert-butyl-5-fluoro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione (PubChem CID 57342686) has the molecular formula C24H31FIN2O8P and a molecular weight of 652.39 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[(6,8-ditert-butyl-5-fluoro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-[(6,8-ditert-butyl-5-fluoro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57342686 |
| Molecular Formula | C24H31FIN2O8P |
| Molecular Weight | 652.39 g/mol |
| Exact Mass | 652.08 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[(6,8-ditert-butyl-5-fluoro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2c(c1F)COP(=O)(O[C@H]1C[C@H](n3cc(I)c(=O)[nH]c3=O)O[C@@H]1CO)O2 |
| InChI | InChI=1S/C24H31FIN2O8P/c1-23(2,3)13-7-14(24(4,5)6)20-12(19(13)25)11-33-37(32,36-20)35-16-8-18(34-17(16)10-29)28-9-15(26)21(30)27-22(28)31/h7,9,16-18,29H,8,10-11H2,1-6H3,(H,27,30,31)/t16-,17+,18+,37?/m0/s1 |
| InChIKey | GYBZJGHCHWYFMW-QYXZXOAVSA-N |
| XLogP | 4.26 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|