C25H33F2N2O7P — CID 57342690
1-[(2R,4S,5R)-5-[(6,8-ditert-butyl-5-fluoro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-4-fluorooxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 57342690) has the molecular formula C25H33F2N2O7P and a molecular weight of 542.52 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-[(6,8-ditert-butyl-5-fluoro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-4-fluorooxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-[(6,8-ditert-butyl-5-fluoro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-4-fluorooxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57342690 |
| Molecular Formula | C25H33F2N2O7P |
| Molecular Weight | 542.52 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 1-[(2R,4S,5R)-5-[(6,8-ditert-butyl-5-fluoro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-4-fluorooxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](F)[C@@H](COP3(=O)OCc4c(F)c(C(C)(C)C)cc(C(C)(C)C)c4O3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H33F2N2O7P/c1-13-10-29(23(31)28-22(13)30)19-9-17(26)18(35-19)12-34-37(32)33-11-14-20(27)15(24(2,3)4)8-16(21(14)36-37)25(5,6)7/h8,10,17-19H,9,11-12H2,1-7H3,(H,28,30,31)/t17-,18+,19+,37?/m0/s1 |
| InChIKey | HJWOBFOEHNCYBU-MRPAQEQASA-N |
| XLogP | 4.94 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|