C10H15F2N2O5P — CID 57342870
[1,1-difluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)pentyl]phosphonic acid (PubChem CID 57342870) has the molecular formula C10H15F2N2O5P and a molecular weight of 312.21 g/mol. Its IUPAC name is [1,1-difluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)pentyl]phosphonic acid.
| Compound Name | [1,1-difluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)pentyl]phosphonic acid |
|---|---|
| PubChem CID | 57342870 |
| Molecular Formula | C10H15F2N2O5P |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | [1,1-difluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)pentyl]phosphonic acid |
| SMILES | Cc1cn(CCCCC(F)(F)P(=O)(O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15F2N2O5P/c1-7-6-14(9(16)13-8(7)15)5-3-2-4-10(11,12)20(17,18)19/h6H,2-5H2,1H3,(H,13,15,16)(H2,17,18,19) |
| InChIKey | LFKPIRDYPZNWCV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|