C49H49N4O8Se — CID 57342970
CID 57342970 (PubChem CID 57342970) has the molecular formula C49H49N4O8Se and a molecular weight of 900.91 g/mol.
| Compound Name | CID 57342970 |
|---|---|
| PubChem CID | 57342970 |
| Molecular Formula | C49H49N4O8Se |
| Molecular Weight | 900.91 g/mol |
| Exact Mass | 901.27 |
| IUPAC Name | — |
| SMILES | CC(C)[C@H](/N=C(\[Se])[C@H](CC(=O)OCc1ccccc1)NC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C49H49N4O8Se/c1-32(2)45(48(57)60-30-35-20-10-5-11-21-35)53-47(62)42(27-44(55)59-29-34-18-8-4-9-19-34)51-43(54)28-50-46(56)41(26-33-16-6-3-7-17-33)52-49(58)61-31-40-38-24-14-12-22-36(38)37-23-13-15-25-39(37)40/h3-25,32,40-42,45H,26-31H2,1-2H3,(H,50,56)(H,51,54)(H,52,58)/b53-47-/t41-,42-,45-/m0/s1 |
| InChIKey | ZJSZTCKORKDZMN-NCRQZYSBSA-N |
| XLogP | 6.21 |
| TPSA | 161.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.91 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|