C14H23F2N2O5P — CID 57343211
[1,1-difluoro-9-(5-methyl-2,4-dioxopyrimidin-1-yl)nonyl]phosphonic acid (PubChem CID 57343211) has the molecular formula C14H23F2N2O5P and a molecular weight of 368.32 g/mol. Its IUPAC name is [1,1-difluoro-9-(5-methyl-2,4-dioxopyrimidin-1-yl)nonyl]phosphonic acid.
| Compound Name | [1,1-difluoro-9-(5-methyl-2,4-dioxopyrimidin-1-yl)nonyl]phosphonic acid |
|---|---|
| PubChem CID | 57343211 |
| Molecular Formula | C14H23F2N2O5P |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | [1,1-difluoro-9-(5-methyl-2,4-dioxopyrimidin-1-yl)nonyl]phosphonic acid |
| SMILES | Cc1cn(CCCCCCCCC(F)(F)P(=O)(O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H23F2N2O5P/c1-11-10-18(13(20)17-12(11)19)9-7-5-3-2-4-6-8-14(15,16)24(21,22)23/h10H,2-9H2,1H3,(H,17,19,20)(H2,21,22,23) |
| InChIKey | XNJMDCNRMWIYKD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|