C22H16F3NO3S — CID 57343263
(3S)-2-(4-methylphenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-3H-isoindol-1-one (PubChem CID 57343263) has the molecular formula C22H16F3NO3S and a molecular weight of 431.44 g/mol. Its IUPAC name is (3S)-2-(4-methylphenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-3H-isoindol-1-one.
| Compound Name | (3S)-2-(4-methylphenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 57343263 |
| Molecular Formula | C22H16F3NO3S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | (3S)-2-(4-methylphenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-3H-isoindol-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)c3ccccc3[C@@H]2c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H16F3NO3S/c1-14-6-12-17(13-7-14)30(28,29)26-20(18-4-2-3-5-19(18)21(26)27)15-8-10-16(11-9-15)22(23,24)25/h2-13,20H,1H3/t20-/m0/s1 |
| InChIKey | BEDMUWIXUSUXAR-FQEVSTJZSA-N |
| XLogP | 4.95 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |