C20H21NO2S2 — CID 57343324
1-(4-methylphenyl)sulfonyl-3-prop-1-en-2-yl-4-(2-thiophen-2-ylethenylidene)pyrrolidine (PubChem CID 57343324) has the molecular formula C20H21NO2S2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3-prop-1-en-2-yl-4-(2-thiophen-2-ylethenylidene)pyrrolidine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3-prop-1-en-2-yl-4-(2-thiophen-2-ylethenylidene)pyrrolidine |
|---|---|
| PubChem CID | 57343324 |
| Molecular Formula | C20H21NO2S2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-prop-1-en-2-yl-4-(2-thiophen-2-ylethenylidene)pyrrolidine |
| SMILES | C=C(C)C1CN(S(=O)(=O)c2ccc(C)cc2)CC1=C=Cc1cccs1 |
| InChI | InChI=1S/C20H21NO2S2/c1-15(2)20-14-21(13-17(20)8-9-18-5-4-12-24-18)25(22,23)19-10-6-16(3)7-11-19/h4-7,9-12,20H,1,13-14H2,2-3H3 |
| InChIKey | HCJVWHDHLZYFBK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|