C20H35F2N2O5PS — CID 57343381
1-[4-[5-di(propan-2-yloxy)phosphoryl-5,5-difluoropentyl]sulfanylbutyl]-5-methylpyrimidine-2,4-dione (PubChem CID 57343381) has the molecular formula C20H35F2N2O5PS and a molecular weight of 484.55 g/mol. Its IUPAC name is 1-[4-[5-di(propan-2-yloxy)phosphoryl-5,5-difluoropentyl]sulfanylbutyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[4-[5-di(propan-2-yloxy)phosphoryl-5,5-difluoropentyl]sulfanylbutyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57343381 |
| Molecular Formula | C20H35F2N2O5PS |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 1-[4-[5-di(propan-2-yloxy)phosphoryl-5,5-difluoropentyl]sulfanylbutyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(CCCCSCCCCC(F)(F)P(=O)(OC(C)C)OC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H35F2N2O5PS/c1-15(2)28-30(27,29-16(3)4)20(21,22)10-6-8-12-31-13-9-7-11-24-14-17(5)18(25)23-19(24)26/h14-16H,6-13H2,1-5H3,(H,23,25,26) |
| InChIKey | JQYQZYSCWQAPMY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|