C29H25NO4S — CID 57343481
(2R,3S)-2-(4-methylphenyl)sulfonyl-3-phenyl-5-oxa-7-azatetracyclo[8.8.0.03,7.012,17]octadeca-1(18),10,12,14,16-pentaen-6-one (PubChem CID 57343481) has the molecular formula C29H25NO4S and a molecular weight of 483.59 g/mol. Its IUPAC name is (2R,3S)-2-(4-methylphenyl)sulfonyl-3-phenyl-5-oxa-7-azatetracyclo[8.8.0.03,7.012,17]octadeca-1(18),10,12,14,16-pentaen-6-one.
| Compound Name | (2R,3S)-2-(4-methylphenyl)sulfonyl-3-phenyl-5-oxa-7-azatetracyclo[8.8.0.03,7.012,17]octadeca-1(18),10,12,14,16-pentaen-6-one |
|---|---|
| PubChem CID | 57343481 |
| Molecular Formula | C29H25NO4S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | (2R,3S)-2-(4-methylphenyl)sulfonyl-3-phenyl-5-oxa-7-azatetracyclo[8.8.0.03,7.012,17]octadeca-1(18),10,12,14,16-pentaen-6-one |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2c3cc4ccccc4cc3CCN3C(=O)OC[C@@]23c2ccccc2)cc1 |
| InChI | InChI=1S/C29H25NO4S/c1-20-11-13-25(14-12-20)35(32,33)27-26-18-22-8-6-5-7-21(22)17-23(26)15-16-30-28(31)34-19-29(27,30)24-9-3-2-4-10-24/h2-14,17-18,27H,15-16,19H2,1H3/t27-,29-/m1/s1 |
| InChIKey | ZQTYMNURONYADG-XRKRLSELSA-N |
| XLogP | 5.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |