C16H12INO2 — CID 57343484
3-iodo-1-methyl-4-phenyl-1-azaspiro[4.5]deca-3,6,9-triene-2,8-di(16O,18O)one (PubChem CID 57343484) has the molecular formula C16H12INO2 and a molecular weight of 379.18 g/mol. Its IUPAC name is 3-iodo-1-methyl-4-phenyl-1-azaspiro[4.5]deca-3,6,9-triene-2,8-di(16O,18O)one.
| Compound Name | 3-iodo-1-methyl-4-phenyl-1-azaspiro[4.5]deca-3,6,9-triene-2,8-di(16O,18O)one |
|---|---|
| PubChem CID | 57343484 |
| Molecular Formula | C16H12INO2 |
| Molecular Weight | 379.18 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 3-iodo-1-methyl-4-phenyl-1-azaspiro[4.5]deca-3,6,9-triene-2,8-di(16O,18O)one |
| SMILES | CN1C(=[16O])C(I)=C(c2ccccc2)C12C=CC(=[18O])C=C2 |
| InChI | InChI=1S/C16H12INO2/c1-18-15(20)14(17)13(11-5-3-2-4-6-11)16(18)9-7-12(19)8-10-16/h2-10H,1H3/i19+2,20+0 |
| InChIKey | BTPCSFAWMOBUEI-OBDMGPPDSA-N |
| XLogP | 2.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.18 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|