C12H19F2N2O5PS — CID 57343539
[1,1-difluoro-5-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl]pentyl]phosphonic acid (PubChem CID 57343539) has the molecular formula C12H19F2N2O5PS and a molecular weight of 372.33 g/mol. Its IUPAC name is [1,1-difluoro-5-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl]pentyl]phosphonic acid.
| Compound Name | [1,1-difluoro-5-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl]pentyl]phosphonic acid |
|---|---|
| PubChem CID | 57343539 |
| Molecular Formula | C12H19F2N2O5PS |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | [1,1-difluoro-5-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl]pentyl]phosphonic acid |
| SMILES | Cc1cn(CCSCCCCC(F)(F)P(=O)(O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H19F2N2O5PS/c1-9-8-16(11(18)15-10(9)17)5-7-23-6-3-2-4-12(13,14)22(19,20)21/h8H,2-7H2,1H3,(H,15,17,18)(H2,19,20,21) |
| InChIKey | HJHYHMJKEHEDAH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|