C14H23F2N2O5PS — CID 57343541
[1,1-difluoro-5-[4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylsulfanyl]pentyl]phosphonic acid (PubChem CID 57343541) has the molecular formula C14H23F2N2O5PS and a molecular weight of 400.38 g/mol. Its IUPAC name is [1,1-difluoro-5-[4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylsulfanyl]pentyl]phosphonic acid.
| Compound Name | [1,1-difluoro-5-[4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylsulfanyl]pentyl]phosphonic acid |
|---|---|
| PubChem CID | 57343541 |
| Molecular Formula | C14H23F2N2O5PS |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | [1,1-difluoro-5-[4-(5-methyl-2,4-dioxopyrimidin-1-yl)butylsulfanyl]pentyl]phosphonic acid |
| SMILES | Cc1cn(CCCCSCCCCC(F)(F)P(=O)(O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H23F2N2O5PS/c1-11-10-18(13(20)17-12(11)19)7-3-5-9-25-8-4-2-6-14(15,16)24(21,22)23/h10H,2-9H2,1H3,(H,17,19,20)(H2,21,22,23) |
| InChIKey | YSCAITJHRYGAQR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|