C16H27F2N2O5PS — CID 57343542
[1,1-difluoro-5-[6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylsulfanyl]pentyl]phosphonic acid (PubChem CID 57343542) has the molecular formula C16H27F2N2O5PS and a molecular weight of 428.44 g/mol. Its IUPAC name is [1,1-difluoro-5-[6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylsulfanyl]pentyl]phosphonic acid.
| Compound Name | [1,1-difluoro-5-[6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylsulfanyl]pentyl]phosphonic acid |
|---|---|
| PubChem CID | 57343542 |
| Molecular Formula | C16H27F2N2O5PS |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | [1,1-difluoro-5-[6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylsulfanyl]pentyl]phosphonic acid |
| SMILES | Cc1cn(CCCCCCSCCCCC(F)(F)P(=O)(O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H27F2N2O5PS/c1-13-12-20(15(22)19-14(13)21)9-5-2-3-6-10-27-11-7-4-8-16(17,18)26(23,24)25/h12H,2-11H2,1H3,(H,19,21,22)(H2,23,24,25) |
| InChIKey | UAAYWCSMROQACZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|