C30H32F2N2O3 — CID 57343909
1-[[4-[[(E)-[3-(3,5-difluorophenyl)-4-(3,4-dimethylphenyl)butan-2-ylidene]amino]oxymethyl]phenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 57343909) has the molecular formula C30H32F2N2O3 and a molecular weight of 506.59 g/mol. Its IUPAC name is 1-[[4-[[(E)-[3-(3,5-difluorophenyl)-4-(3,4-dimethylphenyl)butan-2-ylidene]amino]oxymethyl]phenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[4-[[(E)-[3-(3,5-difluorophenyl)-4-(3,4-dimethylphenyl)butan-2-ylidene]amino]oxymethyl]phenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 57343909 |
| Molecular Formula | C30H32F2N2O3 |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 1-[[4-[[(E)-[3-(3,5-difluorophenyl)-4-(3,4-dimethylphenyl)butan-2-ylidene]amino]oxymethyl]phenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | C/C(=N\OCc1ccc(CN2CC(C(=O)O)C2)cc1)C(Cc1ccc(C)c(C)c1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C30H32F2N2O3/c1-19-4-5-24(10-20(19)2)11-29(25-12-27(31)14-28(32)13-25)21(3)33-37-18-23-8-6-22(7-9-23)15-34-16-26(17-34)30(35)36/h4-10,12-14,26,29H,11,15-18H2,1-3H3,(H,35,36)/b33-21+ |
| InChIKey | GVJOPUCCAPLOTM-QNKGDIEWSA-N |
| XLogP | 6.02 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|