C32H38N4O3 — CID 57343917
2-[1-[(E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoyl]piperidin-4-yl]-2-[[4-(1H-indol-3-yl)cyclohexyl]amino]acetamide (PubChem CID 57343917) has the molecular formula C32H38N4O3 and a molecular weight of 526.68 g/mol. Its IUPAC name is 2-[1-[(E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoyl]piperidin-4-yl]-2-[[4-(1H-indol-3-yl)cyclohexyl]amino]acetamide.
| Compound Name | 2-[1-[(E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoyl]piperidin-4-yl]-2-[[4-(1H-indol-3-yl)cyclohexyl]amino]acetamide |
|---|---|
| PubChem CID | 57343917 |
| Molecular Formula | C32H38N4O3 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | 2-[1-[(E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoyl]piperidin-4-yl]-2-[[4-(1H-indol-3-yl)cyclohexyl]amino]acetamide |
| SMILES | NC(=O)C(NC1CCC(c2c[nH]c3ccccc23)CC1)C1CCN(C(=O)/C=C/c2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C32H38N4O3/c33-32(38)31(35-25-9-7-22(8-10-25)27-20-34-28-4-2-1-3-26(27)28)23-13-16-36(17-14-23)30(37)12-6-21-5-11-29-24(19-21)15-18-39-29/h1-6,11-12,19-20,22-23,25,31,34-35H,7-10,13-18H2,(H2,33,38)/b12-6+ |
| InChIKey | UPXYWLGSJSTBFG-WUXMJOGZSA-N |
| XLogP | 4.52 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|