C31H35F3N4O3 — CID 57344221
2-[[4-(1H-indol-3-yl)cyclohexyl]amino]-2-[1-[(E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoyl]piperidin-4-yl]acetamide (PubChem CID 57344221) has the molecular formula C31H35F3N4O3 and a molecular weight of 568.64 g/mol. Its IUPAC name is 2-[[4-(1H-indol-3-yl)cyclohexyl]amino]-2-[1-[(E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoyl]piperidin-4-yl]acetamide.
| Compound Name | 2-[[4-(1H-indol-3-yl)cyclohexyl]amino]-2-[1-[(E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 57344221 |
| Molecular Formula | C31H35F3N4O3 |
| Molecular Weight | 568.64 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | 2-[[4-(1H-indol-3-yl)cyclohexyl]amino]-2-[1-[(E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoyl]piperidin-4-yl]acetamide |
| SMILES | NC(=O)C(NC1CCC(c2c[nH]c3ccccc23)CC1)C1CCN(C(=O)/C=C/c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C31H35F3N4O3/c32-31(33,34)41-24-12-5-20(6-13-24)7-14-28(39)38-17-15-22(16-18-38)29(30(35)40)37-23-10-8-21(9-11-23)26-19-36-27-4-2-1-3-25(26)27/h1-7,12-14,19,21-23,29,36-37H,8-11,15-18H2,(H2,35,40)/b14-7+ |
| InChIKey | STFZXNFAUSAZFQ-VGOFMYFVSA-N |
| XLogP | 5.49 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.64 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|