C34H42N4O3 — CID 57344302
2-[1-[(E)-3-(2,2-dimethyl-3H-1-benzofuran-5-yl)prop-2-enoyl]piperidin-4-yl]-2-[[4-(1H-indol-3-yl)cyclohexyl]amino]acetamide (PubChem CID 57344302) has the molecular formula C34H42N4O3 and a molecular weight of 554.74 g/mol. Its IUPAC name is 2-[1-[(E)-3-(2,2-dimethyl-3H-1-benzofuran-5-yl)prop-2-enoyl]piperidin-4-yl]-2-[[4-(1H-indol-3-yl)cyclohexyl]amino]acetamide.
| Compound Name | 2-[1-[(E)-3-(2,2-dimethyl-3H-1-benzofuran-5-yl)prop-2-enoyl]piperidin-4-yl]-2-[[4-(1H-indol-3-yl)cyclohexyl]amino]acetamide |
|---|---|
| PubChem CID | 57344302 |
| Molecular Formula | C34H42N4O3 |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | 2-[1-[(E)-3-(2,2-dimethyl-3H-1-benzofuran-5-yl)prop-2-enoyl]piperidin-4-yl]-2-[[4-(1H-indol-3-yl)cyclohexyl]amino]acetamide |
| SMILES | CC1(C)Cc2cc(/C=C/C(=O)N3CCC(C(NC4CCC(c5c[nH]c6ccccc56)CC4)C(N)=O)CC3)ccc2O1 |
| InChI | InChI=1S/C34H42N4O3/c1-34(2)20-25-19-22(7-13-30(25)41-34)8-14-31(39)38-17-15-24(16-18-38)32(33(35)40)37-26-11-9-23(10-12-26)28-21-36-29-6-4-3-5-27(28)29/h3-8,13-14,19,21,23-24,26,32,36-37H,9-12,15-18,20H2,1-2H3,(H2,35,40)/b14-8+ |
| InChIKey | GGIPSJODRAGBRA-RIYZIHGNSA-N |
| XLogP | 5.30 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|