C29H32F3N5O2 — CID 57344307
2-[[4-(1H-pyrrolo[3,2-c]pyridin-3-yl)cyclohexyl]amino]-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]acetamide (PubChem CID 57344307) has the molecular formula C29H32F3N5O2 and a molecular weight of 539.60 g/mol. Its IUPAC name is 2-[[4-(1H-pyrrolo[3,2-c]pyridin-3-yl)cyclohexyl]amino]-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]acetamide.
| Compound Name | 2-[[4-(1H-pyrrolo[3,2-c]pyridin-3-yl)cyclohexyl]amino]-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 57344307 |
| Molecular Formula | C29H32F3N5O2 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 2-[[4-(1H-pyrrolo[3,2-c]pyridin-3-yl)cyclohexyl]amino]-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]acetamide |
| SMILES | NC(=O)C(NC1CCC(c2c[nH]c3ccncc23)CC1)C1CCN(C(=O)/C=C/c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C29H32F3N5O2/c30-23-13-17(14-24(31)27(23)32)1-6-26(38)37-11-8-19(9-12-37)28(29(33)39)36-20-4-2-18(3-5-20)21-16-35-25-7-10-34-15-22(21)25/h1,6-7,10,13-16,18-20,28,35-36H,2-5,8-9,11-12H2,(H2,33,39)/b6-1+ |
| InChIKey | MDFSYIMIGYFWGI-LZCJLJQNSA-N |
| XLogP | 4.40 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|