C32H37F3N4O2 — CID 57344318
2-[[4-(1H-indol-3-yl)cyclohexyl]amino]-N,N-dimethyl-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]acetamide (PubChem CID 57344318) has the molecular formula C32H37F3N4O2 and a molecular weight of 566.67 g/mol. Its IUPAC name is 2-[[4-(1H-indol-3-yl)cyclohexyl]amino]-N,N-dimethyl-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]acetamide.
| Compound Name | 2-[[4-(1H-indol-3-yl)cyclohexyl]amino]-N,N-dimethyl-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 57344318 |
| Molecular Formula | C32H37F3N4O2 |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | 2-[[4-(1H-indol-3-yl)cyclohexyl]amino]-N,N-dimethyl-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]acetamide |
| SMILES | CN(C)C(=O)C(NC1CCC(c2c[nH]c3ccccc23)CC1)C1CCN(C(=O)/C=C/c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C32H37F3N4O2/c1-38(2)32(41)31(37-23-10-8-21(9-11-23)25-19-36-28-6-4-3-5-24(25)28)22-13-15-39(16-14-22)29(40)12-7-20-17-26(33)30(35)27(34)18-20/h3-7,12,17-19,21-23,31,36-37H,8-11,13-16H2,1-2H3/b12-7+ |
| InChIKey | FXQFHLWYGIPPLB-KPKJPENVSA-N |
| XLogP | 5.61 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|