C12H16N2O6 — CID 57344321
1-[(5R,6S,8R,9R)-9-hydroxy-8-(hydroxymethyl)-1,7-dioxaspiro[4.4]nonan-6-yl]pyrimidine-2,4-dione (PubChem CID 57344321) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is 1-[(5R,6S,8R,9R)-9-hydroxy-8-(hydroxymethyl)-1,7-dioxaspiro[4.4]nonan-6-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(5R,6S,8R,9R)-9-hydroxy-8-(hydroxymethyl)-1,7-dioxaspiro[4.4]nonan-6-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57344321 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-[(5R,6S,8R,9R)-9-hydroxy-8-(hydroxymethyl)-1,7-dioxaspiro[4.4]nonan-6-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@H]2O[C@H](CO)[C@@H](O)[C@]23CCCO3)c(=O)[nH]1 |
| InChI | InChI=1S/C12H16N2O6/c15-6-7-9(17)12(3-1-5-19-12)10(20-7)14-4-2-8(16)13-11(14)18/h2,4,7,9-10,15,17H,1,3,5-6H2,(H,13,16,18)/t7-,9-,10+,12-/m1/s1 |
| InChIKey | HZCBTQNWTKRAGQ-ZIYJGFGOSA-N |
| XLogP | -1.66 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |