C17H13ClN4O — CID 57344520
9-(4-chlorophenyl)-3-methyl-5-oxa-4,8,12-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,8,11,13-hexaen-11-amine (PubChem CID 57344520) has the molecular formula C17H13ClN4O and a molecular weight of 324.77 g/mol. Its IUPAC name is 9-(4-chlorophenyl)-3-methyl-5-oxa-4,8,12-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,8,11,13-hexaen-11-amine.
| Compound Name | 9-(4-chlorophenyl)-3-methyl-5-oxa-4,8,12-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,8,11,13-hexaen-11-amine |
|---|---|
| PubChem CID | 57344520 |
| Molecular Formula | C17H13ClN4O |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 9-(4-chlorophenyl)-3-methyl-5-oxa-4,8,12-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,8,11,13-hexaen-11-amine |
| SMILES | Cc1noc2c1-c1ccnc(N)c1C(c1ccc(Cl)cc1)=NC2 |
| InChI | InChI=1S/C17H13ClN4O/c1-9-14-12-6-7-20-17(19)15(12)16(21-8-13(14)23-22-9)10-2-4-11(18)5-3-10/h2-7H,8H2,1H3,(H2,19,20) |
| InChIKey | IIRKIVCLTXICLY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 77.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |