C24H41N — CID 57345065
N-[[(1R,4aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]methyl]-N-ethylethanamine (PubChem CID 57345065) has the molecular formula C24H41N and a molecular weight of 343.60 g/mol. Its IUPAC name is N-[[(1R,4aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]methyl]-N-ethylethanamine.
| Compound Name | N-[[(1R,4aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]methyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 57345065 |
| Molecular Formula | C24H41N |
| Molecular Weight | 343.60 g/mol |
| Exact Mass | 343.32 |
| IUPAC Name | N-[[(1R,4aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]methyl]-N-ethylethanamine |
| SMILES | CCN(CC)C[C@]1(C)CCC[C@]2(C)C3CCC(C(C)C)=CC3=CCC12 |
| InChI | InChI=1S/C24H41N/c1-7-25(8-2)17-23(5)14-9-15-24(6)21-12-10-19(18(3)4)16-20(21)11-13-22(23)24/h11,16,18,21-22H,7-10,12-15,17H2,1-6H3/t21?,22?,23-,24+/m0/s1 |
| InChIKey | PFDOPJKAWZKODU-STTLMXHVSA-N |
| XLogP | 6.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.60 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |