C24H32F2N2O2 — CID 57345501
(2S)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-[1-(4-fluorophenyl)propylamino]-N-hydroxyhexanamide (PubChem CID 57345501) has the molecular formula C24H32F2N2O2 and a molecular weight of 418.53 g/mol. Its IUPAC name is (2S)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-[1-(4-fluorophenyl)propylamino]-N-hydroxyhexanamide.
| Compound Name | (2S)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-[1-(4-fluorophenyl)propylamino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 57345501 |
| Molecular Formula | C24H32F2N2O2 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (2S)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-[1-(4-fluorophenyl)propylamino]-N-hydroxyhexanamide |
| SMILES | CCC(NCCCC[C@@H](Cc1cc(C)c(F)c(C)c1)C(=O)NO)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H32F2N2O2/c1-4-22(19-8-10-21(25)11-9-19)27-12-6-5-7-20(24(29)28-30)15-18-13-16(2)23(26)17(3)14-18/h8-11,13-14,20,22,27,30H,4-7,12,15H2,1-3H3,(H,28,29)/t20-,22?/m0/s1 |
| InChIKey | RKZDOJQKLCPUQZ-AIBWNMTMSA-N |
| XLogP | 5.16 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|