C29H38O2 — CID 57345587
(E)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-(2-methylphenyl)prop-2-en-1-one (PubChem CID 57345587) has the molecular formula C29H38O2 and a molecular weight of 418.62 g/mol. Its IUPAC name is (E)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-(2-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-(2-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 57345587 |
| Molecular Formula | C29H38O2 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | (E)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-(2-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccccc1/C=C/C(=O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H38O2/c1-19-6-4-5-7-20(19)8-13-27(31)26-12-11-24-23-10-9-21-18-22(30)14-16-28(21,2)25(23)15-17-29(24,26)3/h4-9,13,22-26,30H,10-12,14-18H2,1-3H3/b13-8+/t22-,23-,24-,25-,26+,28-,29-/m0/s1 |
| InChIKey | VWOLPPGOLFWUDJ-OROKFEPCSA-N |
| XLogP | 6.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|