About 1-[(2,3-dichlorophenyl)methyl]-2-methyl-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one
1-[(2,3-dichlorophenyl)methyl]-2-methyl-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one (PubChem CID 57345685) has the molecular formula C18H18Cl2N4O2
and a molecular weight of 393.27 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenyl)methyl]-2-methyl-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 1-[(2,3-dichlorophenyl)methyl]-2-methyl-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one |
| PubChem CID | 57345685 |
| Molecular Formula | C18H18Cl2N4O2 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 1-[(2,3-dichlorophenyl)methyl]-2-methyl-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one |
| SMILES | Cc1cn2c(=O)cc(N3CCOCC3)nc2n1Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H18Cl2N4O2/c1-12-10-24-16(25)9-15(22-5-7-26-8-6-22)21-18(24)23(12)11-13-3-2-4-14(19)17(13)20/h2-4,9-10H,5-8,11H2,1H3 |
| InChIKey | SQIHDUNGUKRZME-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(2,3-dichlorophenyl)methyl]-2-methyl-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,3-dichlorophenyl)methyl]-2-methyl-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one?
The IUPAC name of 1-[(2,3-dichlorophenyl)methyl]-2-methyl-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one (CID 57345685) is 1-[(2,3-dichlorophenyl)methyl]-2-methyl-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one.
What is the SMILES notation for 1-[(2,3-dichlorophenyl)methyl]-2-methyl-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one?
The canonical SMILES for 1-[(2,3-dichlorophenyl)methyl]-2-methyl-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one is Cc1cn2c(=O)cc(N3CCOCC3)nc2n1Cc1cccc(Cl)c1Cl.
What is the InChIKey of 1-[(2,3-dichlorophenyl)methyl]-2-methyl-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one?
The InChIKey is SQIHDUNGUKRZME-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18Cl2N4O2/c1-12-10-24-16(25)9-15(22-5-7-26-8-6-22)21-18(24)23(12)11-13-3-2-4-14(19)17(13)20/h2-4,9-10H,5-8,11H2,1H3.
What are the key properties of 1-[(2,3-dichlorophenyl)methyl]-2-methyl-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one?
1-[(2,3-dichlorophenyl)methyl]-2-methyl-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one has a molecular weight of 393.27 g/mol, XLogP of 3.00, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,3-dichlorophenyl)methyl]-2-methyl-7-morpholin-4-ylimidazo[1,2-a]pyrimidin-5-one is sourced from PubChem (CID 57345685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).