C24H32N4S2 — CID 57345744
4-[(1R)-1-cyclohexylethyl]-2-[2-[4-(dimethylamino)phenyl]ethyl]-5-thiophen-3-yl-1,2,4-triazole-3-thione (PubChem CID 57345744) has the molecular formula C24H32N4S2 and a molecular weight of 440.68 g/mol. Its IUPAC name is 4-[(1R)-1-cyclohexylethyl]-2-[2-[4-(dimethylamino)phenyl]ethyl]-5-thiophen-3-yl-1,2,4-triazole-3-thione.
| Compound Name | 4-[(1R)-1-cyclohexylethyl]-2-[2-[4-(dimethylamino)phenyl]ethyl]-5-thiophen-3-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 57345744 |
| Molecular Formula | C24H32N4S2 |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 4-[(1R)-1-cyclohexylethyl]-2-[2-[4-(dimethylamino)phenyl]ethyl]-5-thiophen-3-yl-1,2,4-triazole-3-thione |
| SMILES | C[C@H](C1CCCCC1)n1c(-c2ccsc2)nn(CCc2ccc(N(C)C)cc2)c1=S |
| InChI | InChI=1S/C24H32N4S2/c1-18(20-7-5-4-6-8-20)28-23(21-14-16-30-17-21)25-27(24(28)29)15-13-19-9-11-22(12-10-19)26(2)3/h9-12,14,16-18,20H,4-8,13,15H2,1-3H3/t18-/m1/s1 |
| InChIKey | RVDLTXLVFUNTMM-GOSISDBHSA-N |
| XLogP | 6.59 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|