About 3,4,6-tribromopyridazine
3,4,6-tribromopyridazine (PubChem CID 57345829) has the molecular formula C4HBr3N2
and a molecular weight of 316.78 g/mol. Its IUPAC name is 3,4,6-tribromopyridazine.
Molecular Properties
| Compound Name | 3,4,6-tribromopyridazine |
| PubChem CID | 57345829 |
| Molecular Formula | C4HBr3N2 |
| Molecular Weight | 316.78 g/mol |
| Exact Mass | 313.77 |
| IUPAC Name | 3,4,6-tribromopyridazine |
| SMILES | Brc1cc(Br)c(Br)nn1 |
| InChI | InChI=1S/C4HBr3N2/c5-2-1-3(6)8-9-4(2)7/h1H |
| InChIKey | ZRPHMOREEBHHIM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.78 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4,6-tribromopyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,6-tribromopyridazine?
The IUPAC name of 3,4,6-tribromopyridazine (CID 57345829) is 3,4,6-tribromopyridazine.
What is the SMILES notation for 3,4,6-tribromopyridazine?
The canonical SMILES for 3,4,6-tribromopyridazine is Brc1cc(Br)c(Br)nn1.
What is the InChIKey of 3,4,6-tribromopyridazine?
The InChIKey is ZRPHMOREEBHHIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HBr3N2/c5-2-1-3(6)8-9-4(2)7/h1H.
What are the key properties of 3,4,6-tribromopyridazine?
3,4,6-tribromopyridazine has a molecular weight of 316.78 g/mol, XLogP of 2.76, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,6-tribromopyridazine is sourced from PubChem (CID 57345829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).