C22H30FN3O — CID 57345904
6-[[(3R,4R)-4-[5-(3-fluorophenyl)pentoxy]pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine (PubChem CID 57345904) has the molecular formula C22H30FN3O and a molecular weight of 371.50 g/mol. Its IUPAC name is 6-[[(3R,4R)-4-[5-(3-fluorophenyl)pentoxy]pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine.
| Compound Name | 6-[[(3R,4R)-4-[5-(3-fluorophenyl)pentoxy]pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 57345904 |
| Molecular Formula | C22H30FN3O |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | 6-[[(3R,4R)-4-[5-(3-fluorophenyl)pentoxy]pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine |
| SMILES | Cc1cc(N)nc(C[C@@H]2CNC[C@@H]2OCCCCCc2cccc(F)c2)c1 |
| InChI | InChI=1S/C22H30FN3O/c1-16-10-20(26-22(24)11-16)13-18-14-25-15-21(18)27-9-4-2-3-6-17-7-5-8-19(23)12-17/h5,7-8,10-12,18,21,25H,2-4,6,9,13-15H2,1H3,(H2,24,26)/t18-,21+/m1/s1 |
| InChIKey | AQTALODLFZOZJL-NQIIRXRSSA-N |
| XLogP | 3.67 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|