C21H30N4O — CID 57345909
4-methyl-6-[[(3R,4R)-4-(5-pyridin-2-ylpentoxy)pyrrolidin-3-yl]methyl]pyridin-2-amine (PubChem CID 57345909) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 4-methyl-6-[[(3R,4R)-4-(5-pyridin-2-ylpentoxy)pyrrolidin-3-yl]methyl]pyridin-2-amine.
| Compound Name | 4-methyl-6-[[(3R,4R)-4-(5-pyridin-2-ylpentoxy)pyrrolidin-3-yl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 57345909 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 4-methyl-6-[[(3R,4R)-4-(5-pyridin-2-ylpentoxy)pyrrolidin-3-yl]methyl]pyridin-2-amine |
| SMILES | Cc1cc(N)nc(C[C@@H]2CNC[C@@H]2OCCCCCc2ccccn2)c1 |
| InChI | InChI=1S/C21H30N4O/c1-16-11-19(25-21(22)12-16)13-17-14-23-15-20(17)26-10-6-2-3-7-18-8-4-5-9-24-18/h4-5,8-9,11-12,17,20,23H,2-3,6-7,10,13-15H2,1H3,(H2,22,25)/t17-,20+/m1/s1 |
| InChIKey | CSFKTRORRCGDRY-XLIONFOSSA-N |
| XLogP | 2.93 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|