C39H55O2- — CID 57346047
3-[2-[2,6,6-trimethyl-2-[2,6,6-trimethyl-1-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)-2-bicyclo[3.1.1]heptanyl]-1-bicyclo[3.1.1]heptanyl]phenyl]prop-2-enoate (PubChem CID 57346047) has the molecular formula C39H55O2- and a molecular weight of 555.87 g/mol. Its IUPAC name is 3-[2-[2,6,6-trimethyl-2-[2,6,6-trimethyl-1-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)-2-bicyclo[3.1.1]heptanyl]-1-bicyclo[3.1.1]heptanyl]phenyl]prop-2-enoate.
| Compound Name | 3-[2-[2,6,6-trimethyl-2-[2,6,6-trimethyl-1-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)-2-bicyclo[3.1.1]heptanyl]-1-bicyclo[3.1.1]heptanyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 57346047 |
| Molecular Formula | C39H55O2- |
| Molecular Weight | 555.87 g/mol |
| Exact Mass | 555.42 |
| IUPAC Name | 3-[2-[2,6,6-trimethyl-2-[2,6,6-trimethyl-1-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)-2-bicyclo[3.1.1]heptanyl]-1-bicyclo[3.1.1]heptanyl]phenyl]prop-2-enoate |
| SMILES | CC1(C)C2CCC(C)(C34CC(CCC3(C)C3(C)CCC5CC3(c3ccccc3C=CC(=O)[O-])C5(C)C)C4(C)C)C1C2 |
| InChI | InChI=1S/C39H56O2/c1-32(2)26-16-19-35(7,30(32)22-26)39-24-28(34(39,5)6)18-21-37(39,9)36(8)20-17-27-23-38(36,33(27,3)4)29-13-11-10-12-25(29)14-15-31(40)41/h10-15,26-28,30H,16-24H2,1-9H3,(H,40,41)/p-1 |
| InChIKey | JTYSPSWMNIGZPR-UHFFFAOYSA-M |
| XLogP | 8.83 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.87 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|