C12H16O — CID 57346130
1,2,3,4,4a,5a,6,7-octahydrodibenzofuran (PubChem CID 57346130) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 1,2,3,4,4a,5a,6,7-octahydrodibenzofuran.
| Compound Name | 1,2,3,4,4a,5a,6,7-octahydrodibenzofuran |
|---|---|
| PubChem CID | 57346130 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 1,2,3,4,4a,5a,6,7-octahydrodibenzofuran |
| SMILES | C1=CC2=C3CCCCC3OC2CC1 |
| InChI | InChI=1S/C12H16O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1,5,11-12H,2-4,6-8H2 |
| InChIKey | XYNFCXHYLIVEFK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |