About (1R)-1-[5-(2-hydroxyethyl)pyrazin-2-yl]ethane-1,2-diol
(1R)-1-[5-(2-hydroxyethyl)pyrazin-2-yl]ethane-1,2-diol (PubChem CID 57346401) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is (1R)-1-[5-(2-hydroxyethyl)pyrazin-2-yl]ethane-1,2-diol.
Molecular Properties
| Compound Name | (1R)-1-[5-(2-hydroxyethyl)pyrazin-2-yl]ethane-1,2-diol |
| PubChem CID | 57346401 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | (1R)-1-[5-(2-hydroxyethyl)pyrazin-2-yl]ethane-1,2-diol |
| SMILES | OCCc1cnc([C@@H](O)CO)cn1 |
| InChI | InChI=1S/C8H12N2O3/c11-2-1-6-3-10-7(4-9-6)8(13)5-12/h3-4,8,11-13H,1-2,5H2/t8-/m0/s1 |
| InChIKey | UHLOTLAGSJOGNS-QMMMGPOBSA-N |
| XLogP | -0.96 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1R)-1-[5-(2-hydroxyethyl)pyrazin-2-yl]ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[5-(2-hydroxyethyl)pyrazin-2-yl]ethane-1,2-diol?
The IUPAC name of (1R)-1-[5-(2-hydroxyethyl)pyrazin-2-yl]ethane-1,2-diol (CID 57346401) is (1R)-1-[5-(2-hydroxyethyl)pyrazin-2-yl]ethane-1,2-diol.
What is the SMILES notation for (1R)-1-[5-(2-hydroxyethyl)pyrazin-2-yl]ethane-1,2-diol?
The canonical SMILES for (1R)-1-[5-(2-hydroxyethyl)pyrazin-2-yl]ethane-1,2-diol is OCCc1cnc([C@@H](O)CO)cn1.
What is the InChIKey of (1R)-1-[5-(2-hydroxyethyl)pyrazin-2-yl]ethane-1,2-diol?
The InChIKey is UHLOTLAGSJOGNS-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H12N2O3/c11-2-1-6-3-10-7(4-9-6)8(13)5-12/h3-4,8,11-13H,1-2,5H2/t8-/m0/s1.
What are the key properties of (1R)-1-[5-(2-hydroxyethyl)pyrazin-2-yl]ethane-1,2-diol?
(1R)-1-[5-(2-hydroxyethyl)pyrazin-2-yl]ethane-1,2-diol has a molecular weight of 184.19 g/mol, XLogP of -0.96, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[5-(2-hydroxyethyl)pyrazin-2-yl]ethane-1,2-diol is sourced from PubChem (CID 57346401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).