About (1R)-1-hydroxy-3,6-dioxabicyclo[3.2.1]octan-2-one
(1R)-1-hydroxy-3,6-dioxabicyclo[3.2.1]octan-2-one (PubChem CID 57346809) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is (1R)-1-hydroxy-3,6-dioxabicyclo[3.2.1]octan-2-one.
Molecular Properties
| Compound Name | (1R)-1-hydroxy-3,6-dioxabicyclo[3.2.1]octan-2-one |
| PubChem CID | 57346809 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | (1R)-1-hydroxy-3,6-dioxabicyclo[3.2.1]octan-2-one |
| SMILES | O=C1OCC2C[C@@]1(O)CO2 |
| InChI | InChI=1S/C6H8O4/c7-5-6(8)1-4(2-9-5)10-3-6/h4,8H,1-3H2/t4?,6-/m1/s1 |
| InChIKey | UQAWOOIZSRDPLA-BAFYGKSASA-N |
| XLogP | -0.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1R)-1-hydroxy-3,6-dioxabicyclo[3.2.1]octan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-hydroxy-3,6-dioxabicyclo[3.2.1]octan-2-one?
The IUPAC name of (1R)-1-hydroxy-3,6-dioxabicyclo[3.2.1]octan-2-one (CID 57346809) is (1R)-1-hydroxy-3,6-dioxabicyclo[3.2.1]octan-2-one.
What is the SMILES notation for (1R)-1-hydroxy-3,6-dioxabicyclo[3.2.1]octan-2-one?
The canonical SMILES for (1R)-1-hydroxy-3,6-dioxabicyclo[3.2.1]octan-2-one is O=C1OCC2C[C@@]1(O)CO2.
What is the InChIKey of (1R)-1-hydroxy-3,6-dioxabicyclo[3.2.1]octan-2-one?
The InChIKey is UQAWOOIZSRDPLA-BAFYGKSASA-N. The full InChI is InChI=1S/C6H8O4/c7-5-6(8)1-4(2-9-5)10-3-6/h4,8H,1-3H2/t4?,6-/m1/s1.
What are the key properties of (1R)-1-hydroxy-3,6-dioxabicyclo[3.2.1]octan-2-one?
(1R)-1-hydroxy-3,6-dioxabicyclo[3.2.1]octan-2-one has a molecular weight of 144.13 g/mol, XLogP of -0.94, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-hydroxy-3,6-dioxabicyclo[3.2.1]octan-2-one is sourced from PubChem (CID 57346809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).