C30H50O3 — CID 57346959
[(1S,2R,11S,12S,15R,16R)-2,6,16-trimethyl-15-[(2R)-6-methylheptan-2-yl]-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-5-yl] acetate (PubChem CID 57346959) has the molecular formula C30H50O3 and a molecular weight of 458.73 g/mol. Its IUPAC name is [(1S,2R,11S,12S,15R,16R)-2,6,16-trimethyl-15-[(2R)-6-methylheptan-2-yl]-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-5-yl] acetate.
| Compound Name | [(1S,2R,11S,12S,15R,16R)-2,6,16-trimethyl-15-[(2R)-6-methylheptan-2-yl]-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-5-yl] acetate |
|---|---|
| PubChem CID | 57346959 |
| Molecular Formula | C30H50O3 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 458.38 |
| IUPAC Name | [(1S,2R,11S,12S,15R,16R)-2,6,16-trimethyl-15-[(2R)-6-methylheptan-2-yl]-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-5-yl] acetate |
| SMILES | CC(=O)OC1CC[C@]2(C)[C@H]3CC[C@]4(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]4[C@@H]3CCC23OC13C |
| InChI | InChI=1S/C30H50O3/c1-19(2)9-8-10-20(3)23-11-12-24-22-13-18-30-28(6,25(22)14-16-27(23,24)5)17-15-26(32-21(4)31)29(30,7)33-30/h19-20,22-26H,8-18H2,1-7H3/t20-,22+,23-,24+,25+,26?,27-,28-,29?,30?/m1/s1 |
| InChIKey | WBEVTJNIYWJANT-BSYCYESBSA-N |
| XLogP | 7.56 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|