About propanenitrilium hexafluorophosphate
propanenitrilium hexafluorophosphate (PubChem CID 57347104) has the molecular formula C3H6F6NP
and a molecular weight of 201.05 g/mol. Its IUPAC name is propanenitrilium hexafluorophosphate.
Molecular Properties
| Compound Name | propanenitrilium hexafluorophosphate |
| PubChem CID | 57347104 |
| Molecular Formula | C3H6F6NP |
| Molecular Weight | 201.05 g/mol |
| Exact Mass | 201.01 |
| IUPAC Name | propanenitrilium hexafluorophosphate |
| SMILES | CCC#[NH+].F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C3H5N.F6P/c1-2-3-4;1-7(2,3,4,5)6/h2H2,1H3;/q;-1/p+1 |
| InChIKey | UCJAHKIJEFLQMX-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 23.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.05 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze propanenitrilium hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanenitrilium hexafluorophosphate?
The IUPAC name of propanenitrilium hexafluorophosphate (CID 57347104) is propanenitrilium hexafluorophosphate.
What is the SMILES notation for propanenitrilium hexafluorophosphate?
The canonical SMILES for propanenitrilium hexafluorophosphate is CCC#[NH+].F[P-](F)(F)(F)(F)F.
What is the InChIKey of propanenitrilium hexafluorophosphate?
The InChIKey is UCJAHKIJEFLQMX-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H5N.F6P/c1-2-3-4;1-7(2,3,4,5)6/h2H2,1H3;/q;-1/p+1.
What are the key properties of propanenitrilium hexafluorophosphate?
propanenitrilium hexafluorophosphate has a molecular weight of 201.05 g/mol, XLogP of 2.55, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for propanenitrilium hexafluorophosphate is sourced from PubChem (CID 57347104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).