C25H36O2 — CID 57347173
3-benzylidene-5,5-ditert-butyl-4-hydroxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 57347173) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is 3-benzylidene-5,5-ditert-butyl-4-hydroxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | 3-benzylidene-5,5-ditert-butyl-4-hydroxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 57347173 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 3-benzylidene-5,5-ditert-butyl-4-hydroxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC(C)(C)C1(C(C)(C)C)CC2(C)C(=O)C(=Cc3ccccc3)C1(O)C2(C)C |
| InChI | InChI=1S/C25H36O2/c1-20(2,3)24(21(4,5)6)16-23(9)19(26)18(25(24,27)22(23,7)8)15-17-13-11-10-12-14-17/h10-15,27H,16H2,1-9H3 |
| InChIKey | PMNJLDUKECQBJN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|