C19H21N3OS — CID 57347703
2-(4-benzo[b][1,4]benzothiazepin-6-yl-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)ethanol (PubChem CID 57347703) has the molecular formula C19H21N3OS and a molecular weight of 347.51 g/mol. Its IUPAC name is 2-(4-benzo[b][1,4]benzothiazepin-6-yl-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)ethanol.
| Compound Name | 2-(4-benzo[b][1,4]benzothiazepin-6-yl-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)ethanol |
|---|---|
| PubChem CID | 57347703 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 2-(4-benzo[b][1,4]benzothiazepin-6-yl-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)ethanol |
| SMILES | [2H]C1([2H])N(CCO)C([2H])([2H])C([2H])([2H])N(C2=Nc3ccccc3Sc3ccccc32)C1([2H])[2H] |
| InChI | InChI=1S/C19H21N3OS/c23-14-13-21-9-11-22(12-10-21)19-15-5-1-3-7-17(15)24-18-8-4-2-6-16(18)20-19/h1-8,23H,9-14H2/i9D2,10D2,11D2,12D2 |
| InChIKey | OFLMIXVKBNAUIB-PMCMNDOISA-N |
| XLogP | 2.84 |
| TPSA | 39.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |