About Xeroform
Xeroform (PubChem CID 57347797) has the molecular formula C6H3BiBr3O
and a molecular weight of 539.78 g/mol.
Molecular Properties
| Compound Name | Xeroform |
| PubChem CID | 57347797 |
| Molecular Formula | C6H3BiBr3O |
| Molecular Weight | 539.78 g/mol |
| Exact Mass | 536.75 |
| IUPAC Name | — |
| SMILES | Oc1c(Br)cc(Br)cc1Br.[Bi] |
| InChI | InChI=1S/C6H3Br3O.Bi/c7-3-1-4(8)6(10)5(9)2-3;/h1-2,10H; |
| InChIKey | ASNXTBLZRUQMFQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 539.78 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Xeroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Xeroform?
The IUPAC name of Xeroform (CID 57347797) is not available.
What is the SMILES notation for Xeroform?
The canonical SMILES for Xeroform is Oc1c(Br)cc(Br)cc1Br.[Bi].
What is the InChIKey of Xeroform?
The InChIKey is ASNXTBLZRUQMFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Br3O.Bi/c7-3-1-4(8)6(10)5(9)2-3;/h1-2,10H;.
What are the key properties of Xeroform?
Xeroform has a molecular weight of 539.78 g/mol, XLogP of 3.30, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Xeroform is sourced from PubChem (CID 57347797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).