C9H10O — CID 57347851
4-ethenyl-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 57347851) has the molecular formula C9H10O and a molecular weight of 134.18 g/mol. Its IUPAC name is 4-ethenyl-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene.
| Compound Name | 4-ethenyl-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene |
|---|---|
| PubChem CID | 57347851 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 4-ethenyl-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | C=CC1=CC2OC2(C)C=C1 |
| InChI | InChI=1S/C9H10O/c1-3-7-4-5-9(2)8(6-7)10-9/h3-6,8H,1H2,2H3 |
| InChIKey | CMKLOFDTZOOHDZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|