About 4-N,4-N-dibutylbenzo[g]phthalazine-1,4-diamine
4-N,4-N-dibutylbenzo[g]phthalazine-1,4-diamine (PubChem CID 57347994) has the molecular formula C20H26N4
and a molecular weight of 322.46 g/mol. Its IUPAC name is 4-N,4-N-dibutylbenzo[g]phthalazine-1,4-diamine.
Molecular Properties
| Compound Name | 4-N,4-N-dibutylbenzo[g]phthalazine-1,4-diamine |
| PubChem CID | 57347994 |
| Molecular Formula | C20H26N4 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 4-N,4-N-dibutylbenzo[g]phthalazine-1,4-diamine |
| SMILES | CCCCN(CCCC)c1nnc(N)c2cc3ccccc3cc12 |
| InChI | InChI=1S/C20H26N4/c1-3-5-11-24(12-6-4-2)20-18-14-16-10-8-7-9-15(16)13-17(18)19(21)22-23-20/h7-10,13-14H,3-6,11-12H2,1-2H3,(H2,21,22) |
| InChIKey | AOHBHDLQXFWDQZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-N,4-N-dibutylbenzo[g]phthalazine-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N-dibutylbenzo[g]phthalazine-1,4-diamine?
The IUPAC name of 4-N,4-N-dibutylbenzo[g]phthalazine-1,4-diamine (CID 57347994) is 4-N,4-N-dibutylbenzo[g]phthalazine-1,4-diamine.
What is the SMILES notation for 4-N,4-N-dibutylbenzo[g]phthalazine-1,4-diamine?
The canonical SMILES for 4-N,4-N-dibutylbenzo[g]phthalazine-1,4-diamine is CCCCN(CCCC)c1nnc(N)c2cc3ccccc3cc12.
What is the InChIKey of 4-N,4-N-dibutylbenzo[g]phthalazine-1,4-diamine?
The InChIKey is AOHBHDLQXFWDQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4/c1-3-5-11-24(12-6-4-2)20-18-14-16-10-8-7-9-15(16)13-17(18)19(21)22-23-20/h7-10,13-14H,3-6,11-12H2,1-2H3,(H2,21,22).
What are the key properties of 4-N,4-N-dibutylbenzo[g]phthalazine-1,4-diamine?
4-N,4-N-dibutylbenzo[g]phthalazine-1,4-diamine has a molecular weight of 322.46 g/mol, XLogP of 4.77, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N-dibutylbenzo[g]phthalazine-1,4-diamine is sourced from PubChem (CID 57347994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).