C19H26N2O4S — CID 57348140
5-methyl-1-(2-pentan-2-yloxyethoxymethyl)-6-phenylsulfanylpyrimidine-2,4-dione (PubChem CID 57348140) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is 5-methyl-1-(2-pentan-2-yloxyethoxymethyl)-6-phenylsulfanylpyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-(2-pentan-2-yloxyethoxymethyl)-6-phenylsulfanylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57348140 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 5-methyl-1-(2-pentan-2-yloxyethoxymethyl)-6-phenylsulfanylpyrimidine-2,4-dione |
| SMILES | CCCC(C)OCCOCn1c(Sc2ccccc2)c(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H26N2O4S/c1-4-8-14(2)25-12-11-24-13-21-18(15(3)17(22)20-19(21)23)26-16-9-6-5-7-10-16/h5-7,9-10,14H,4,8,11-13H2,1-3H3,(H,20,22,23) |
| InChIKey | QJOKRUKECPXFDT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|