C10H19O4P — CID 57348632
(1,2-diethylcyclopentanecarbonyl)phosphonic acid (PubChem CID 57348632) has the molecular formula C10H19O4P and a molecular weight of 234.23 g/mol. Its IUPAC name is (1,2-diethylcyclopentanecarbonyl)phosphonic acid.
| Compound Name | (1,2-diethylcyclopentanecarbonyl)phosphonic acid |
|---|---|
| PubChem CID | 57348632 |
| Molecular Formula | C10H19O4P |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (1,2-diethylcyclopentanecarbonyl)phosphonic acid |
| SMILES | CCC1CCCC1(CC)C(=O)P(=O)(O)O |
| InChI | InChI=1S/C10H19O4P/c1-3-8-6-5-7-10(8,4-2)9(11)15(12,13)14/h8H,3-7H2,1-2H3,(H2,12,13,14) |
| InChIKey | INDQZYLKFFPNNB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|