azanylidynemethanesulfinyl fluoride

CFNOS — CID 57348697

IUPACazanylidynemethanesulfinyl fluoride
SMILESN#CS(=O)F
InChIInChI=1S/CFNOS/c2-5(4)1-3
InChIKeyRBVNABOHCXKJFJ-UHFFFAOYSA-N
MW93.08 g/mol
LogP0.10
Rot. Bonds

About azanylidynemethanesulfinyl fluoride

azanylidynemethanesulfinyl fluoride (PubChem CID 57348697) has the molecular formula CFNOS and a molecular weight of 93.08 g/mol. Its IUPAC name is azanylidynemethanesulfinyl fluoride.

Molecular Properties

Compound Nameazanylidynemethanesulfinyl fluoride
PubChem CID57348697
Molecular FormulaCFNOS
Molecular Weight93.08 g/mol
Exact Mass92.97
IUPAC Nameazanylidynemethanesulfinyl fluoride
SMILESN#CS(=O)F
InChIInChI=1S/CFNOS/c2-5(4)1-3
InChIKeyRBVNABOHCXKJFJ-UHFFFAOYSA-N
XLogP0.10
TPSA40.86 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms5
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50093.08
LogP ≤ 50.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}

Analyze azanylidynemethanesulfinyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azanylidynemethanesulfinyl fluoride?
The IUPAC name of azanylidynemethanesulfinyl fluoride (CID 57348697) is azanylidynemethanesulfinyl fluoride.
What is the SMILES notation for azanylidynemethanesulfinyl fluoride?
The canonical SMILES for azanylidynemethanesulfinyl fluoride is N#CS(=O)F.
What is the InChIKey of azanylidynemethanesulfinyl fluoride?
The InChIKey is RBVNABOHCXKJFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/CFNOS/c2-5(4)1-3.
What are the key properties of azanylidynemethanesulfinyl fluoride?
azanylidynemethanesulfinyl fluoride has a molecular weight of 93.08 g/mol, XLogP of 0.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanylidynemethanesulfinyl fluoride is sourced from PubChem (CID 57348697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).