About [1,2]dioxino[4,3-c]pyridine
[1,2]dioxino[4,3-c]pyridine (PubChem CID 57348888) has the molecular formula C7H5NO2
and a molecular weight of 135.12 g/mol. Its IUPAC name is [1,2]dioxino[4,3-c]pyridine.
Molecular Properties
| Compound Name | [1,2]dioxino[4,3-c]pyridine |
| PubChem CID | 57348888 |
| Molecular Formula | C7H5NO2 |
| Molecular Weight | 135.12 g/mol |
| Exact Mass | 135.03 |
| IUPAC Name | [1,2]dioxino[4,3-c]pyridine |
| SMILES | C1=Cc2cnccc2OO1 |
| InChI | InChI=1S/C7H5NO2/c1-3-8-5-6-2-4-9-10-7(1)6/h1-5H |
| InChIKey | NVVMDHPPJYKNCG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.12 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [1,2]dioxino[4,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2]dioxino[4,3-c]pyridine?
The IUPAC name of [1,2]dioxino[4,3-c]pyridine (CID 57348888) is [1,2]dioxino[4,3-c]pyridine.
What is the SMILES notation for [1,2]dioxino[4,3-c]pyridine?
The canonical SMILES for [1,2]dioxino[4,3-c]pyridine is C1=Cc2cnccc2OO1.
What is the InChIKey of [1,2]dioxino[4,3-c]pyridine?
The InChIKey is NVVMDHPPJYKNCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO2/c1-3-8-5-6-2-4-9-10-7(1)6/h1-5H.
What are the key properties of [1,2]dioxino[4,3-c]pyridine?
[1,2]dioxino[4,3-c]pyridine has a molecular weight of 135.12 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2]dioxino[4,3-c]pyridine is sourced from PubChem (CID 57348888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).